C16H23N3O3S — CID 118379604
3-(benzoylcarbamothioylamino)propyl-tert-butylcarbamic acid (PubChem CID 118379604) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is 3-(benzoylcarbamothioylamino)propyl-tert-butylcarbamic acid.
| Compound Name | 3-(benzoylcarbamothioylamino)propyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 118379604 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 3-(benzoylcarbamothioylamino)propyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CCCNC(=S)NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H23N3O3S/c1-16(2,3)19(15(21)22)11-7-10-17-14(23)18-13(20)12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3,(H,21,22)(H2,17,18,20,23) |
| InChIKey | HNDFTUNIBIPNGQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|