C20H29N3O3S — CID 54093188
[4-(benzoylcarbamothioylamino)cyclohexyl]methyl-tert-butylcarbamic acid (PubChem CID 54093188) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is [4-(benzoylcarbamothioylamino)cyclohexyl]methyl-tert-butylcarbamic acid.
| Compound Name | [4-(benzoylcarbamothioylamino)cyclohexyl]methyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 54093188 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | [4-(benzoylcarbamothioylamino)cyclohexyl]methyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CC1CCC(NC(=S)NC(=O)c2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C20H29N3O3S/c1-20(2,3)23(19(25)26)13-14-9-11-16(12-10-14)21-18(27)22-17(24)15-7-5-4-6-8-15/h4-8,14,16H,9-13H2,1-3H3,(H,25,26)(H2,21,22,24,27) |
| InChIKey | MVHKWJDWBLQILH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|