C13H15ClN2OS — CID 4922300
4-chloro-N-(cyclopentylcarbamothioyl)benzamide (PubChem CID 4922300) has the molecular formula C13H15ClN2OS and a molecular weight of 282.80 g/mol. Its IUPAC name is 4-chloro-N-(cyclopentylcarbamothioyl)benzamide.
| Compound Name | 4-chloro-N-(cyclopentylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 4922300 |
| Molecular Formula | C13H15ClN2OS |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 4-chloro-N-(cyclopentylcarbamothioyl)benzamide |
| SMILES | O=C(NC(=S)NC1CCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H15ClN2OS/c14-10-7-5-9(6-8-10)12(17)16-13(18)15-11-3-1-2-4-11/h5-8,11H,1-4H2,(H2,15,16,17,18) |
| InChIKey | JITYTRLIXSDFOR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|