C12H13ClN2O3S2 — CID 42473109
4-chloro-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamothioyl]benzamide (PubChem CID 42473109) has the molecular formula C12H13ClN2O3S2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 4-chloro-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamothioyl]benzamide.
| Compound Name | 4-chloro-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 42473109 |
| Molecular Formula | C12H13ClN2O3S2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 4-chloro-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)N[C@H]1CCS(=O)(=O)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN2O3S2/c13-9-3-1-8(2-4-9)11(16)15-12(19)14-10-5-6-20(17,18)7-10/h1-4,10H,5-7H2,(H2,14,15,16,19)/t10-/m0/s1 |
| InChIKey | KKLCQJSTFCIDBE-JTQLQIEISA-N |
| XLogP | 1.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|