C26H23ClN2O4S2 — CID 98092527
N-[(Z)-1-(4-chlorophenyl)sulfanyl-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 98092527) has the molecular formula C26H23ClN2O4S2 and a molecular weight of 527.07 g/mol. Its IUPAC name is N-[(Z)-1-(4-chlorophenyl)sulfanyl-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-chlorophenyl)sulfanyl-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 98092527 |
| Molecular Formula | C26H23ClN2O4S2 |
| Molecular Weight | 527.07 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | N-[(Z)-1-(4-chlorophenyl)sulfanyl-3-[[(3S)-1,1-dioxothiolan-3-yl]amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)/C(NC(=O)c1ccccc1)=C(/Sc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H23ClN2O4S2/c27-20-11-13-22(14-12-20)34-24(18-7-3-1-4-8-18)23(29-25(30)19-9-5-2-6-10-19)26(31)28-21-15-16-35(32,33)17-21/h1-14,21H,15-17H2,(H,28,31)(H,29,30)/b24-23-/t21-/m0/s1 |
| InChIKey | DSKRYGQITIHYLL-HGJUWQSKSA-N |
| XLogP | 4.53 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.07 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|