C24H28ClN2O7PS — CID 71952198
N-[1-(4-chlorophenyl)-1-diethoxyphosphoryl-3-[(1,1-dioxothiolan-3-yl)amino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 71952198) has the molecular formula C24H28ClN2O7PS and a molecular weight of 554.99 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-1-diethoxyphosphoryl-3-[(1,1-dioxothiolan-3-yl)amino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(4-chlorophenyl)-1-diethoxyphosphoryl-3-[(1,1-dioxothiolan-3-yl)amino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 71952198 |
| Molecular Formula | C24H28ClN2O7PS |
| Molecular Weight | 554.99 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)-1-diethoxyphosphoryl-3-[(1,1-dioxothiolan-3-yl)amino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOP(=O)(OCC)C(=C(NC(=O)c1ccccc1)C(=O)NC1CCS(=O)(=O)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H28ClN2O7PS/c1-3-33-35(30,34-4-2)22(17-10-12-19(25)13-11-17)21(27-23(28)18-8-6-5-7-9-18)24(29)26-20-14-15-36(31,32)16-20/h5-13,20H,3-4,14-16H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | XIIGNHGQZMOGOX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.99 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|