C27H25ClF3N2O5P — CID 6185614
N-[(Z)-3-[2-chloro-4-(trifluoromethyl)anilino]-1-diethoxyphosphoryl-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 6185614) has the molecular formula C27H25ClF3N2O5P and a molecular weight of 580.93 g/mol. Its IUPAC name is N-[(Z)-3-[2-chloro-4-(trifluoromethyl)anilino]-1-diethoxyphosphoryl-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[2-chloro-4-(trifluoromethyl)anilino]-1-diethoxyphosphoryl-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6185614 |
| Molecular Formula | C27H25ClF3N2O5P |
| Molecular Weight | 580.93 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | N-[(Z)-3-[2-chloro-4-(trifluoromethyl)anilino]-1-diethoxyphosphoryl-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | CCOP(=O)(OCC)/C(=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(C(F)(F)F)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C27H25ClF3N2O5P/c1-3-37-39(36,38-4-2)24(18-11-7-5-8-12-18)23(33-25(34)19-13-9-6-10-14-19)26(35)32-22-16-15-20(17-21(22)28)27(29,30)31/h5-17H,3-4H2,1-2H3,(H,32,35)(H,33,34)/b24-23- |
| InChIKey | MAFQICLGYKSIAM-VHXPQNKSSA-N |
| XLogP | 7.36 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.93 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|