C19H19ClN2O4S — CID 31725806
4-chloro-N-[(1S)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxo-2-phenylethyl]benzamide (PubChem CID 31725806) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is 4-chloro-N-[(1S)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxo-2-phenylethyl]benzamide.
| Compound Name | 4-chloro-N-[(1S)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxo-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 31725806 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 4-chloro-N-[(1S)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxo-2-phenylethyl]benzamide |
| SMILES | O=C(N[C@H](N[C@H]1CCS(=O)(=O)C1)C(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2O4S/c20-15-8-6-14(7-9-15)19(24)22-18(17(23)13-4-2-1-3-5-13)21-16-10-11-27(25,26)12-16/h1-9,16,18,21H,10-12H2,(H,22,24)/t16-,18-/m0/s1 |
| InChIKey | SPKCBQWZGLVATM-WMZOPIPTSA-N |
| XLogP | 2.06 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|