C17H18N2O4S2 — CID 1257999
N-[(1R)-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxo-2-thiophen-2-ylethyl]benzamide (PubChem CID 1257999) has the molecular formula C17H18N2O4S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[(1R)-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxo-2-thiophen-2-ylethyl]benzamide.
| Compound Name | N-[(1R)-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxo-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 1257999 |
| Molecular Formula | C17H18N2O4S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[(1R)-1-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxo-2-thiophen-2-ylethyl]benzamide |
| SMILES | O=C(N[C@@H](N[C@@H]1CCS(=O)(=O)C1)C(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O4S2/c20-15(14-7-4-9-24-14)16(18-13-8-10-25(22,23)11-13)19-17(21)12-5-2-1-3-6-12/h1-7,9,13,16,18H,8,10-11H2,(H,19,21)/t13-,16-/m1/s1 |
| InChIKey | XBBJMTRPJFXMQC-CZUORRHYSA-N |
| XLogP | 1.46 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|