C21H20N2O3S — CID 1161225
N-[(1R)-1-(2-ethoxyanilino)-2-oxo-2-thiophen-2-ylethyl]benzamide (PubChem CID 1161225) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[(1R)-1-(2-ethoxyanilino)-2-oxo-2-thiophen-2-ylethyl]benzamide.
| Compound Name | N-[(1R)-1-(2-ethoxyanilino)-2-oxo-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 1161225 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[(1R)-1-(2-ethoxyanilino)-2-oxo-2-thiophen-2-ylethyl]benzamide |
| SMILES | CCOc1ccccc1N[C@H](NC(=O)c1ccccc1)C(=O)c1cccs1 |
| InChI | InChI=1S/C21H20N2O3S/c1-2-26-17-12-7-6-11-16(17)22-20(19(24)18-13-8-14-27-18)23-21(25)15-9-4-3-5-10-15/h3-14,20,22H,2H2,1H3,(H,23,25)/t20-/m1/s1 |
| InChIKey | LGOWIFRARZZMLR-HXUWFJFHSA-N |
| XLogP | 4.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|