C22H22N2O3S — CID 34311100
N-[(1R)-1-(2-ethoxyanilino)-2-(4-methylphenyl)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 34311100) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[(1R)-1-(2-ethoxyanilino)-2-(4-methylphenyl)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1R)-1-(2-ethoxyanilino)-2-(4-methylphenyl)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 34311100 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[(1R)-1-(2-ethoxyanilino)-2-(4-methylphenyl)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CCOc1ccccc1N[C@H](NC(=O)c1cccs1)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H22N2O3S/c1-3-27-18-8-5-4-7-17(18)23-21(24-22(26)19-9-6-14-28-19)20(25)16-12-10-15(2)11-13-16/h4-14,21,23H,3H2,1-2H3,(H,24,26)/t21-/m1/s1 |
| InChIKey | UTMXIVRLPCUDLL-OAQYLSRUSA-N |
| XLogP | 4.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|