C17H18N2O2S — CID 1226913
N-[(2-ethoxyphenyl)carbamothioyl]-4-methylbenzamide (PubChem CID 1226913) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)carbamothioyl]-4-methylbenzamide.
| Compound Name | N-[(2-ethoxyphenyl)carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 1226913 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[(2-ethoxyphenyl)carbamothioyl]-4-methylbenzamide |
| SMILES | CCOc1ccccc1NC(=S)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-3-21-15-7-5-4-6-14(15)18-17(22)19-16(20)13-10-8-12(2)9-11-13/h4-11H,3H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | KTEJWPGSCXMGLB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|