C16H14F2N2O2S — CID 3680959
N-[[2-(difluoromethoxy)phenyl]carbamothioyl]-4-methylbenzamide (PubChem CID 3680959) has the molecular formula C16H14F2N2O2S and a molecular weight of 336.36 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]carbamothioyl]-4-methylbenzamide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3680959 |
| Molecular Formula | C16H14F2N2O2S |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]carbamothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccccc2OC(F)F)cc1 |
| InChI | InChI=1S/C16H14F2N2O2S/c1-10-6-8-11(9-7-10)14(21)20-16(23)19-12-4-2-3-5-13(12)22-15(17)18/h2-9,15H,1H3,(H2,19,20,21,23) |
| InChIKey | HOKXOHYYUGZLGP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|