C16H13F3N2OS — CID 880639
4-methyl-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 880639) has the molecular formula C16H13F3N2OS and a molecular weight of 338.35 g/mol. Its IUPAC name is 4-methyl-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-methyl-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 880639 |
| Molecular Formula | C16H13F3N2OS |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 4-methyl-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F3N2OS/c1-10-6-8-11(9-7-10)14(22)21-15(23)20-13-5-3-2-4-12(13)16(17,18)19/h2-9H,1H3,(H2,20,21,22,23) |
| InChIKey | RFRWUXTTZJJLAD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|