C15H10BrF3N2OS — CID 1048167
2-bromo-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 1048167) has the molecular formula C15H10BrF3N2OS and a molecular weight of 403.22 g/mol. Its IUPAC name is 2-bromo-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1048167 |
| Molecular Formula | C15H10BrF3N2OS |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 2-bromo-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(F)(F)F)c1ccccc1Br |
| InChI | InChI=1S/C15H10BrF3N2OS/c16-11-7-3-1-5-9(11)13(22)21-14(23)20-12-8-4-2-6-10(12)15(17,18)19/h1-8H,(H2,20,21,22,23) |
| InChIKey | DXDFMDJAPMWCOQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|