C21H23F3N2O4S — CID 1337775
3,4,5-triethoxy-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 1337775) has the molecular formula C21H23F3N2O4S and a molecular weight of 456.49 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1337775 |
| Molecular Formula | C21H23F3N2O4S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 3,4,5-triethoxy-N-[[2-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2ccccc2C(F)(F)F)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H23F3N2O4S/c1-4-28-16-11-13(12-17(29-5-2)18(16)30-6-3)19(27)26-20(31)25-15-10-8-7-9-14(15)21(22,23)24/h7-12H,4-6H2,1-3H3,(H2,25,26,27,31) |
| InChIKey | QRKPCTNWGMFYSQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|