C23H30N2O3S — CID 4950954
N-[(2-ethoxyphenyl)carbamothioyl]-4-heptoxybenzamide (PubChem CID 4950954) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)carbamothioyl]-4-heptoxybenzamide.
| Compound Name | N-[(2-ethoxyphenyl)carbamothioyl]-4-heptoxybenzamide |
|---|---|
| PubChem CID | 4950954 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-[(2-ethoxyphenyl)carbamothioyl]-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)Nc2ccccc2OCC)cc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-3-5-6-7-10-17-28-19-15-13-18(14-16-19)22(26)25-23(29)24-20-11-8-9-12-21(20)27-4-2/h8-9,11-16H,3-7,10,17H2,1-2H3,(H2,24,25,26,29) |
| InChIKey | FEDQLIDFFONWBW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|