C28H32N2O4S — CID 17131060
4-hexoxy-N-[[2-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17131060) has the molecular formula C28H32N2O4S and a molecular weight of 492.64 g/mol. Its IUPAC name is 4-hexoxy-N-[[2-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-hexoxy-N-[[2-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17131060 |
| Molecular Formula | C28H32N2O4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 4-hexoxy-N-[[2-(2-phenoxyethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2ccccc2OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C28H32N2O4S/c1-2-3-4-10-19-32-24-17-15-22(16-18-24)27(31)30-28(35)29-25-13-8-9-14-26(25)34-21-20-33-23-11-6-5-7-12-23/h5-9,11-18H,2-4,10,19-21H2,1H3,(H2,29,30,31,35) |
| InChIKey | LJTKADHNECWPKP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|