C21H20N2O4S — CID 34318112
N-[(1R)-1-(2,5-dimethoxyanilino)-2-oxo-2-thiophen-2-ylethyl]benzamide (PubChem CID 34318112) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethoxyanilino)-2-oxo-2-thiophen-2-ylethyl]benzamide.
| Compound Name | N-[(1R)-1-(2,5-dimethoxyanilino)-2-oxo-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 34318112 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethoxyanilino)-2-oxo-2-thiophen-2-ylethyl]benzamide |
| SMILES | COc1ccc(OC)c(N[C@H](NC(=O)c2ccccc2)C(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H20N2O4S/c1-26-15-10-11-17(27-2)16(13-15)22-20(19(24)18-9-6-12-28-18)23-21(25)14-7-4-3-5-8-14/h3-13,20,22H,1-2H3,(H,23,25)/t20-/m1/s1 |
| InChIKey | LMOZTMTVEMKSLX-HXUWFJFHSA-N |
| XLogP | 3.82 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|