C23H18N2O2S — CID 1000427
N-[(1S)-1-(naphthalen-2-ylamino)-2-oxo-2-phenylethyl]thiophene-2-carboxamide (PubChem CID 1000427) has the molecular formula C23H18N2O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[(1S)-1-(naphthalen-2-ylamino)-2-oxo-2-phenylethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1S)-1-(naphthalen-2-ylamino)-2-oxo-2-phenylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1000427 |
| Molecular Formula | C23H18N2O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-[(1S)-1-(naphthalen-2-ylamino)-2-oxo-2-phenylethyl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H](Nc1ccc2ccccc2c1)C(=O)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C23H18N2O2S/c26-21(17-8-2-1-3-9-17)22(25-23(27)20-11-6-14-28-20)24-19-13-12-16-7-4-5-10-18(16)15-19/h1-15,22,24H,(H,25,27)/t22-/m0/s1 |
| InChIKey | IBMISQLAQVJSNZ-QFIPXVFZSA-N |
| XLogP | 4.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|