C18H21N2O2S+ — CID 7405169
N-[(1R)-2-oxo-2-phenyl-1-piperidin-1-ium-1-ylethyl]thiophene-2-carboxamide (PubChem CID 7405169) has the molecular formula C18H21N2O2S+ and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[(1R)-2-oxo-2-phenyl-1-piperidin-1-ium-1-ylethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1R)-2-oxo-2-phenyl-1-piperidin-1-ium-1-ylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7405169 |
| Molecular Formula | C18H21N2O2S+ |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[(1R)-2-oxo-2-phenyl-1-piperidin-1-ium-1-ylethyl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@@H](C(=O)c1ccccc1)[NH+]1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C18H20N2O2S/c21-16(14-8-3-1-4-9-14)17(20-11-5-2-6-12-20)19-18(22)15-10-7-13-23-15/h1,3-4,7-10,13,17H,2,5-6,11-12H2,(H,19,22)/p+1/t17-/m1/s1 |
| InChIKey | FLCGGNJEJPRNLB-QGZVFWFLSA-O |
| XLogP | 1.76 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |