C7H6Cl3NO2S — CID 794769
N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]thiophene-2-carboxamide (PubChem CID 794769) has the molecular formula C7H6Cl3NO2S and a molecular weight of 274.56 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 794769 |
| Molecular Formula | C7H6Cl3NO2S |
| Molecular Weight | 274.56 g/mol |
| Exact Mass | 272.92 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H](O)C(Cl)(Cl)Cl)c1cccs1 |
| InChI | InChI=1S/C7H6Cl3NO2S/c8-7(9,10)6(13)11-5(12)4-2-1-3-14-4/h1-3,6,13H,(H,11,12)/t6-/m1/s1 |
| InChIKey | HEHHMKKVHJGVHL-ZCFIWIBFSA-N |
| XLogP | 2.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|