C13H17Cl3N2OS — CID 1100413
N-[(1R)-2,2,2-trichloro-1-(cyclohexylamino)ethyl]thiophene-2-carboxamide (PubChem CID 1100413) has the molecular formula C13H17Cl3N2OS and a molecular weight of 355.72 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-(cyclohexylamino)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-(cyclohexylamino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1100413 |
| Molecular Formula | C13H17Cl3N2OS |
| Molecular Weight | 355.72 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-(cyclohexylamino)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@@H](NC1CCCCC1)C(Cl)(Cl)Cl)c1cccs1 |
| InChI | InChI=1S/C13H17Cl3N2OS/c14-13(15,16)12(17-9-5-2-1-3-6-9)18-11(19)10-7-4-8-20-10/h4,7-9,12,17H,1-3,5-6H2,(H,18,19)/t12-/m1/s1 |
| InChIKey | CLMJESKGHLCROD-GFCCVEGCSA-N |
| XLogP | 4.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|