C13H23Cl3N2O — CID 3096961
2,2-dimethyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]propanamide (PubChem CID 3096961) has the molecular formula C13H23Cl3N2O and a molecular weight of 329.70 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 3096961 |
| Molecular Formula | C13H23Cl3N2O |
| Molecular Weight | 329.70 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2,2-dimethyl-N-[2,2,2-trichloro-1-(cyclohexylamino)ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NC(NC1CCCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H23Cl3N2O/c1-12(2,3)11(19)18-10(13(14,15)16)17-9-7-5-4-6-8-9/h9-10,17H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | XHOUYHOVQHYXQI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.70 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|