C16H18Cl3N3O4S — CID 1192101
N-[(1S)-2,2,2-trichloro-1-(cyclopentylamino)ethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide (PubChem CID 1192101) has the molecular formula C16H18Cl3N3O4S and a molecular weight of 454.76 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(cyclopentylamino)ethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(cyclopentylamino)ethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 1192101 |
| Molecular Formula | C16H18Cl3N3O4S |
| Molecular Weight | 454.76 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(cyclopentylamino)ethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2S1(=O)=O)N[C@H](NC1CCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H18Cl3N3O4S/c17-16(18,19)15(20-10-5-1-2-6-10)21-13(23)9-22-14(24)11-7-3-4-8-12(11)27(22,25)26/h3-4,7-8,10,15,20H,1-2,5-6,9H2,(H,21,23)/t15-/m0/s1 |
| InChIKey | FMBVEHCVMAYCMW-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.76 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|