C19H18Cl3N3O4S — CID 4635045
N-[2,2,2-trichloro-1-[(4-methylphenyl)methylamino]ethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide (PubChem CID 4635045) has the molecular formula C19H18Cl3N3O4S and a molecular weight of 490.80 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(4-methylphenyl)methylamino]ethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide.
| Compound Name | N-[2,2,2-trichloro-1-[(4-methylphenyl)methylamino]ethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4635045 |
| Molecular Formula | C19H18Cl3N3O4S |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 489.01 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(4-methylphenyl)methylamino]ethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide |
| SMILES | Cc1ccc(CNC(NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H18Cl3N3O4S/c1-12-6-8-13(9-7-12)10-23-18(19(20,21)22)24-16(26)11-25-17(27)14-4-2-3-5-15(14)30(25,28)29/h2-9,18,23H,10-11H2,1H3,(H,24,26) |
| InChIKey | UNJSRKLDBLTKOV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|