C19H16Cl3N3O5S — CID 1192099
N-[(1R)-1-(3-acetylanilino)-2,2,2-trichloroethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide (PubChem CID 1192099) has the molecular formula C19H16Cl3N3O5S and a molecular weight of 504.78 g/mol. Its IUPAC name is N-[(1R)-1-(3-acetylanilino)-2,2,2-trichloroethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide.
| Compound Name | N-[(1R)-1-(3-acetylanilino)-2,2,2-trichloroethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 1192099 |
| Molecular Formula | C19H16Cl3N3O5S |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | N-[(1R)-1-(3-acetylanilino)-2,2,2-trichloroethyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide |
| SMILES | CC(=O)c1cccc(N[C@H](NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C19H16Cl3N3O5S/c1-11(26)12-5-4-6-13(9-12)23-18(19(20,21)22)24-16(27)10-25-17(28)14-7-2-3-8-15(14)31(25,29)30/h2-9,18,23H,10H2,1H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | JJCGDYMYRSCXIQ-GOSISDBHSA-N |
| XLogP | 2.96 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|