C17H14N2O6S — CID 6501514
methyl 3-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]benzoate (PubChem CID 6501514) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is methyl 3-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 6501514 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | methyl 3-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CN2C(=O)c3ccccc3S2(=O)=O)c1 |
| InChI | InChI=1S/C17H14N2O6S/c1-25-17(22)11-5-4-6-12(9-11)18-15(20)10-19-16(21)13-7-2-3-8-14(13)26(19,23)24/h2-9H,10H2,1H3,(H,18,20) |
| InChIKey | QLLFEYRJHYAZPC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |