C15H11N2O4S2- — CID 135787655
2-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]benzenethiolate (PubChem CID 135787655) has the molecular formula C15H11N2O4S2- and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]benzenethiolate.
| Compound Name | 2-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]benzenethiolate |
|---|---|
| PubChem CID | 135787655 |
| Molecular Formula | C15H11N2O4S2- |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2-[[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetyl]amino]benzenethiolate |
| SMILES | O=C(CN1C(=O)c2ccccc2S1(=O)=O)Nc1ccccc1[S-] |
| InChI | InChI=1S/C15H12N2O4S2/c18-14(16-11-6-2-3-7-12(11)22)9-17-15(19)10-5-1-4-8-13(10)23(17,20)21/h1-8,22H,9H2,(H,16,18)/p-1 |
| InChIKey | MQZBJIOZZWOLLH-UHFFFAOYSA-M |
| XLogP | 1.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|