C15H11N3O6S — CID 4291348
N-(3-nitrophenyl)-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide (PubChem CID 4291348) has the molecular formula C15H11N3O6S and a molecular weight of 361.34 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide.
| Compound Name | N-(3-nitrophenyl)-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4291348 |
| Molecular Formula | C15H11N3O6S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(3-nitrophenyl)-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2S1(=O)=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11N3O6S/c19-14(16-10-4-3-5-11(8-10)18(21)22)9-17-15(20)12-6-1-2-7-13(12)25(17,23)24/h1-8H,9H2,(H,16,19) |
| InChIKey | XSLINAUAPBLYPM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|