C20H23ClN6O6 — CID 175654144
2-[4-[2-(3-nitroanilino)-2-oxoethyl]piperazin-1-yl]-N-(3-nitrophenyl)acetamide;hydrochloride (PubChem CID 175654144) has the molecular formula C20H23ClN6O6 and a molecular weight of 478.89 g/mol. Its IUPAC name is 2-[4-[2-(3-nitroanilino)-2-oxoethyl]piperazin-1-yl]-N-(3-nitrophenyl)acetamide;hydrochloride.
| Compound Name | 2-[4-[2-(3-nitroanilino)-2-oxoethyl]piperazin-1-yl]-N-(3-nitrophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 175654144 |
| Molecular Formula | C20H23ClN6O6 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[4-[2-(3-nitroanilino)-2-oxoethyl]piperazin-1-yl]-N-(3-nitrophenyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CCN(CC(=O)Nc2cccc([N+](=O)[O-])c2)CC1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22N6O6.ClH/c27-19(21-15-3-1-5-17(11-15)25(29)30)13-23-7-9-24(10-8-23)14-20(28)22-16-4-2-6-18(12-16)26(31)32;/h1-6,11-12H,7-10,13-14H2,(H,21,27)(H,22,28);1H |
| InChIKey | VLBDMKMZBIZFFY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|