C20H24N4O3 — CID 16608517
2-(4-benzyl-1,4-diazepan-1-yl)-N-(3-nitrophenyl)acetamide (PubChem CID 16608517) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-(4-benzyl-1,4-diazepan-1-yl)-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(4-benzyl-1,4-diazepan-1-yl)-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16608517 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-(4-benzyl-1,4-diazepan-1-yl)-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(CN1CCCN(Cc2ccccc2)CC1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H24N4O3/c25-20(21-18-8-4-9-19(14-18)24(26)27)16-23-11-5-10-22(12-13-23)15-17-6-2-1-3-7-17/h1-4,6-9,14H,5,10-13,15-16H2,(H,21,25) |
| InChIKey | QHFMLMMQCKXHMY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|