C13H17N3O3 — CID 687323
N-(3-nitrophenyl)-2-piperidin-1-ylacetamide (PubChem CID 687323) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-piperidin-1-ylacetamide.
| Compound Name | N-(3-nitrophenyl)-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 687323 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(3-nitrophenyl)-2-piperidin-1-ylacetamide |
| SMILES | O=C(CN1CCCCC1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N3O3/c17-13(10-15-7-2-1-3-8-15)14-11-5-4-6-12(9-11)16(18)19/h4-6,9H,1-3,7-8,10H2,(H,14,17) |
| InChIKey | VNKKYMYQWARECN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|