C19H18N6O5S — CID 11840150
2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 11840150) has the molecular formula C19H18N6O5S and a molecular weight of 442.46 g/mol. Its IUPAC name is 2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 11840150 |
| Molecular Formula | C19H18N6O5S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(CN1CCN(c2nc3ccc([N+](=O)[O-])cc3s2)CC1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18N6O5S/c26-18(20-13-2-1-3-14(10-13)24(27)28)12-22-6-8-23(9-7-22)19-21-16-5-4-15(25(29)30)11-17(16)31-19/h1-5,10-11H,6-9,12H2,(H,20,26) |
| InChIKey | MNPFVXOXOSYINB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|