C20H20N6O5S — CID 44896553
2-nitro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]benzamide (PubChem CID 44896553) has the molecular formula C20H20N6O5S and a molecular weight of 456.48 g/mol. Its IUPAC name is 2-nitro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]benzamide.
| Compound Name | 2-nitro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 44896553 |
| Molecular Formula | C20H20N6O5S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-nitro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1CCN(c2nc3ccc([N+](=O)[O-])cc3s2)CC1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N6O5S/c27-19(15-3-1-2-4-17(15)26(30)31)21-7-8-23-9-11-24(12-10-23)20-22-16-6-5-14(25(28)29)13-18(16)32-20/h1-6,13H,7-12H2,(H,21,27) |
| InChIKey | TYTKXUUUBBZJTR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|