C18H17Cl2N5O3S2 — CID 44896549
2,5-dichloro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]thiophene-3-carboxamide (PubChem CID 44896549) has the molecular formula C18H17Cl2N5O3S2 and a molecular weight of 486.41 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 44896549 |
| Molecular Formula | C18H17Cl2N5O3S2 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | 2,5-dichloro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCN1CCN(c2nc3ccc([N+](=O)[O-])cc3s2)CC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C18H17Cl2N5O3S2/c19-15-10-12(16(20)30-15)17(26)21-3-4-23-5-7-24(8-6-23)18-22-13-2-1-11(25(27)28)9-14(13)29-18/h1-2,9-10H,3-8H2,(H,21,26) |
| InChIKey | WOBFZGQIWZHWMN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|