C20H20Cl2N6O5S — CID 44896554
2-chloro-5-nitro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]benzamide;hydrochloride (PubChem CID 44896554) has the molecular formula C20H20Cl2N6O5S and a molecular weight of 527.39 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]benzamide;hydrochloride.
| Compound Name | 2-chloro-5-nitro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 44896554 |
| Molecular Formula | C20H20Cl2N6O5S |
| Molecular Weight | 527.39 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | 2-chloro-5-nitro-N-[2-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]benzamide;hydrochloride |
| SMILES | Cl.O=C(NCCN1CCN(c2nc3ccc([N+](=O)[O-])cc3s2)CC1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C20H19ClN6O5S.ClH/c21-16-3-1-13(26(29)30)11-15(16)19(28)22-5-6-24-7-9-25(10-8-24)20-23-17-4-2-14(27(31)32)12-18(17)33-20;/h1-4,11-12H,5-10H2,(H,22,28);1H |
| InChIKey | JUKXXUDNJWUUGQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|