C17H18N4O2S2 — CID 56574403
6-nitro-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]-1,3-benzothiazole (PubChem CID 56574403) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 6-nitro-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 6-nitro-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 56574403 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 6-nitro-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(N3CCN(CCc4cccs4)CC3)sc2c1 |
| InChI | InChI=1S/C17H18N4O2S2/c22-21(23)13-3-4-15-16(12-13)25-17(18-15)20-9-7-19(8-10-20)6-5-14-2-1-11-24-14/h1-4,11-12H,5-10H2 |
| InChIKey | MDAUHDHQMDJFDU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|