C12H13N3O2S3 — CID 125483623
2-(1,5,3-dithiazocan-3-yl)-6-nitro-1,3-benzothiazole (PubChem CID 125483623) has the molecular formula C12H13N3O2S3 and a molecular weight of 327.46 g/mol. Its IUPAC name is 2-(1,5,3-dithiazocan-3-yl)-6-nitro-1,3-benzothiazole.
| Compound Name | 2-(1,5,3-dithiazocan-3-yl)-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 125483623 |
| Molecular Formula | C12H13N3O2S3 |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 2-(1,5,3-dithiazocan-3-yl)-6-nitro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(N3CSCCCSC3)sc2c1 |
| InChI | InChI=1S/C12H13N3O2S3/c16-15(17)9-2-3-10-11(6-9)20-12(13-10)14-7-18-4-1-5-19-8-14/h2-3,6H,1,4-5,7-8H2 |
| InChIKey | DFFOMDFGNZMXJA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|