C17H15ClN4O2S — CID 56553475
2-[4-(3-chlorophenyl)piperazin-1-yl]-6-nitro-1,3-benzothiazole (PubChem CID 56553475) has the molecular formula C17H15ClN4O2S and a molecular weight of 374.85 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-6-nitro-1,3-benzothiazole.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 56553475 |
| Molecular Formula | C17H15ClN4O2S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-6-nitro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(N3CCN(c4cccc(Cl)c4)CC3)sc2c1 |
| InChI | InChI=1S/C17H15ClN4O2S/c18-12-2-1-3-13(10-12)20-6-8-21(9-7-20)17-19-15-5-4-14(22(23)24)11-16(15)25-17/h1-5,10-11H,6-9H2 |
| InChIKey | FPUMWEDMICWROQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|