C13H15N3O3S — CID 97290130
[1-(6-nitro-1,3-benzothiazol-2-yl)piperidin-4-yl]methanol (PubChem CID 97290130) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is [1-(6-nitro-1,3-benzothiazol-2-yl)piperidin-4-yl]methanol.
| Compound Name | [1-(6-nitro-1,3-benzothiazol-2-yl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 97290130 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | [1-(6-nitro-1,3-benzothiazol-2-yl)piperidin-4-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc2nc(N3CCC(CO)CC3)sc2c1 |
| InChI | InChI=1S/C13H15N3O3S/c17-8-9-3-5-15(6-4-9)13-14-11-2-1-10(16(18)19)7-12(11)20-13/h1-2,7,9,17H,3-6,8H2 |
| InChIKey | QCSSGXBXOSQGRL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|