C11H11N3O3S — CID 71649797
1-(5-nitro-1,3-benzothiazol-2-yl)pyrrolidin-3-ol (PubChem CID 71649797) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 1-(5-nitro-1,3-benzothiazol-2-yl)pyrrolidin-3-ol.
| Compound Name | 1-(5-nitro-1,3-benzothiazol-2-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 71649797 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 1-(5-nitro-1,3-benzothiazol-2-yl)pyrrolidin-3-ol |
| SMILES | O=[N+]([O-])c1ccc2sc(N3CCC(O)C3)nc2c1 |
| InChI | InChI=1S/C11H11N3O3S/c15-8-3-4-13(6-8)11-12-9-5-7(14(16)17)1-2-10(9)18-11/h1-2,5,8,15H,3-4,6H2 |
| InChIKey | UKZGVQVXYGPVKG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|