C12H12N4O4S — CID 97169322
(2S)-4-(5-nitro-1,3-benzothiazol-2-yl)piperazine-2-carboxylic acid (PubChem CID 97169322) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is (2S)-4-(5-nitro-1,3-benzothiazol-2-yl)piperazine-2-carboxylic acid.
| Compound Name | (2S)-4-(5-nitro-1,3-benzothiazol-2-yl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 97169322 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (2S)-4-(5-nitro-1,3-benzothiazol-2-yl)piperazine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(c2nc3cc([N+](=O)[O-])ccc3s2)CCN1 |
| InChI | InChI=1S/C12H12N4O4S/c17-11(18)9-6-15(4-3-13-9)12-14-8-5-7(16(19)20)1-2-10(8)21-12/h1-2,5,9,13H,3-4,6H2,(H,17,18)/t9-/m0/s1 |
| InChIKey | KWALAJVAFFVSTD-VIFPVBQESA-N |
| XLogP | 1.07 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|