C18H15IN4O3S — CID 41115763
(2-iodophenyl)-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone (PubChem CID 41115763) has the molecular formula C18H15IN4O3S and a molecular weight of 494.31 g/mol. Its IUPAC name is (2-iodophenyl)-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone.
| Compound Name | (2-iodophenyl)-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 41115763 |
| Molecular Formula | C18H15IN4O3S |
| Molecular Weight | 494.31 g/mol |
| Exact Mass | 493.99 |
| IUPAC Name | (2-iodophenyl)-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1I)N1CCN(c2nc3ccc([N+](=O)[O-])cc3s2)CC1 |
| InChI | InChI=1S/C18H15IN4O3S/c19-14-4-2-1-3-13(14)17(24)21-7-9-22(10-8-21)18-20-15-6-5-12(23(25)26)11-16(15)27-18/h1-6,11H,7-10H2 |
| InChIKey | JPAITXZPJWLVIY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|