C16H13N5O6S — CID 41115711
[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(5-nitrofuran-2-yl)methanone (PubChem CID 41115711) has the molecular formula C16H13N5O6S and a molecular weight of 403.38 g/mol. Its IUPAC name is [4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(5-nitrofuran-2-yl)methanone.
| Compound Name | [4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 41115711 |
| Molecular Formula | C16H13N5O6S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | [4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(5-nitrofuran-2-yl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N1CCN(c2nc3ccc([N+](=O)[O-])cc3s2)CC1 |
| InChI | InChI=1S/C16H13N5O6S/c22-15(12-3-4-14(27-12)21(25)26)18-5-7-19(8-6-18)16-17-11-2-1-10(20(23)24)9-13(11)28-16/h1-4,9H,5-8H2 |
| InChIKey | ADDDBDBRNFKETA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 135.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|