C19H17BrN4O3S — CID 43982357
1-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-(4-nitrophenyl)ethanone (PubChem CID 43982357) has the molecular formula C19H17BrN4O3S and a molecular weight of 461.34 g/mol. Its IUPAC name is 1-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-(4-nitrophenyl)ethanone.
| Compound Name | 1-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 43982357 |
| Molecular Formula | C19H17BrN4O3S |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 1-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-2-(4-nitrophenyl)ethanone |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)N1CCN(c2nc3ccc(Br)cc3s2)CC1 |
| InChI | InChI=1S/C19H17BrN4O3S/c20-14-3-6-16-17(12-14)28-19(21-16)23-9-7-22(8-10-23)18(25)11-13-1-4-15(5-2-13)24(26)27/h1-6,12H,7-11H2 |
| InChIKey | VYUUKEUUJLKXFA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|