C18H14BrClN4O3S — CID 41115595
[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-(5-chloro-2-nitrophenyl)methanone (PubChem CID 41115595) has the molecular formula C18H14BrClN4O3S and a molecular weight of 481.76 g/mol. Its IUPAC name is [4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-(5-chloro-2-nitrophenyl)methanone.
| Compound Name | [4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-(5-chloro-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 41115595 |
| Molecular Formula | C18H14BrClN4O3S |
| Molecular Weight | 481.76 g/mol |
| Exact Mass | 479.97 |
| IUPAC Name | [4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-(5-chloro-2-nitrophenyl)methanone |
| SMILES | O=C(c1cc(Cl)ccc1[N+](=O)[O-])N1CCN(c2nc3ccc(Br)cc3s2)CC1 |
| InChI | InChI=1S/C18H14BrClN4O3S/c19-11-1-3-14-16(9-11)28-18(21-14)23-7-5-22(6-8-23)17(25)13-10-12(20)2-4-15(13)24(26)27/h1-4,9-10H,5-8H2 |
| InChIKey | RHIOZBLYVLQARK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.76 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|