C19H17ClN4O5S2 — CID 41115802
2-(4-chlorophenyl)sulfonyl-1-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone (PubChem CID 41115802) has the molecular formula C19H17ClN4O5S2 and a molecular weight of 480.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-1-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-1-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 41115802 |
| Molecular Formula | C19H17ClN4O5S2 |
| Molecular Weight | 480.96 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-1-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone |
| SMILES | O=C(CS(=O)(=O)c1ccc(Cl)cc1)N1CCN(c2nc3ccc([N+](=O)[O-])cc3s2)CC1 |
| InChI | InChI=1S/C19H17ClN4O5S2/c20-13-1-4-15(5-2-13)31(28,29)12-18(25)22-7-9-23(10-8-22)19-21-16-6-3-14(24(26)27)11-17(16)30-19/h1-6,11H,7-10,12H2 |
| InChIKey | UNFSLKBDJVWIJK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.96 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|