C24H27N5O5S2 — CID 43981770
[4-(azepan-1-ylsulfonyl)phenyl]-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone (PubChem CID 43981770) has the molecular formula C24H27N5O5S2 and a molecular weight of 529.64 g/mol. Its IUPAC name is [4-(azepan-1-ylsulfonyl)phenyl]-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone.
| Compound Name | [4-(azepan-1-ylsulfonyl)phenyl]-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 43981770 |
| Molecular Formula | C24H27N5O5S2 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | [4-(azepan-1-ylsulfonyl)phenyl]-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCCCCC2)cc1)N1CCN(c2nc3ccc([N+](=O)[O-])cc3s2)CC1 |
| InChI | InChI=1S/C24H27N5O5S2/c30-23(18-5-8-20(9-6-18)36(33,34)28-11-3-1-2-4-12-28)26-13-15-27(16-14-26)24-25-21-10-7-19(29(31)32)17-22(21)35-24/h5-10,17H,1-4,11-16H2 |
| InChIKey | QJBVFIVVTDVZSF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 116.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|