C27H25N5O5S2 — CID 43981775
[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone (PubChem CID 43981775) has the molecular formula C27H25N5O5S2 and a molecular weight of 563.66 g/mol. Its IUPAC name is [4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone.
| Compound Name | [4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 43981775 |
| Molecular Formula | C27H25N5O5S2 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | [4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCc3ccccc3C2)cc1)N1CCN(c2nc3ccc([N+](=O)[O-])cc3s2)CC1 |
| InChI | InChI=1S/C27H25N5O5S2/c33-26(29-13-15-30(16-14-29)27-28-24-10-7-22(32(34)35)17-25(24)38-27)20-5-8-23(9-6-20)39(36,37)31-12-11-19-3-1-2-4-21(19)18-31/h1-10,17H,11-16,18H2 |
| InChIKey | OYBILJLILVZPGQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 116.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|